C19H26FN3O4 — CID 25338272
1-[(1S,2S,3S,4R,5R)-2-[(4-fluorophenyl)methylamino]-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]piperidine-4-carboxamide (PubChem CID 25338272) has the molecular formula C19H26FN3O4 and a molecular weight of 379.43 g/mol. Its IUPAC name is 1-[(1S,2S,3S,4R,5R)-2-[(4-fluorophenyl)methylamino]-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]piperidine-4-carboxamide.
| Compound Name | 1-[(1S,2S,3S,4R,5R)-2-[(4-fluorophenyl)methylamino]-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 25338272 |
| Molecular Formula | C19H26FN3O4 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 1-[(1S,2S,3S,4R,5R)-2-[(4-fluorophenyl)methylamino]-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN([C@H]2[C@@H]3OC[C@@H](O3)[C@@H](NCc3ccc(F)cc3)[C@@H]2O)CC1 |
| InChI | InChI=1S/C19H26FN3O4/c20-13-3-1-11(2-4-13)9-22-15-14-10-26-19(27-14)16(17(15)24)23-7-5-12(6-8-23)18(21)25/h1-4,12,14-17,19,22,24H,5-10H2,(H2,21,25)/t14-,15-,16-,17+,19-/m1/s1 |
| InChIKey | RVOGUJWVVJVYDS-ZQOJQMTGSA-N |
| XLogP | -0.03 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |