About methyl (6S)-3-benzyl-5-(2-phenoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylate
methyl (6S)-3-benzyl-5-(2-phenoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylate (PubChem CID 25338966) has the molecular formula C23H23N3O4
and a molecular weight of 405.45 g/mol. Its IUPAC name is methyl (6S)-3-benzyl-5-(2-phenoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylate.
Molecular Properties
| Compound Name | methyl (6S)-3-benzyl-5-(2-phenoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylate |
| PubChem CID | 25338966 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | methyl (6S)-3-benzyl-5-(2-phenoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2ncn(Cc3ccccc3)c2CN1C(=O)COc1ccccc1 |
| InChI | InChI=1S/C23H23N3O4/c1-29-23(28)20-12-19-21(25(16-24-19)13-17-8-4-2-5-9-17)14-26(20)22(27)15-30-18-10-6-3-7-11-18/h2-11,16,20H,12-15H2,1H3/t20-/m0/s1 |
| InChIKey | DRULHSJGKMQNAA-FQEVSTJZSA-N |
| XLogP | 2.44 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl (6S)-3-benzyl-5-(2-phenoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (6S)-3-benzyl-5-(2-phenoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylate?
The IUPAC name of methyl (6S)-3-benzyl-5-(2-phenoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylate (CID 25338966) is methyl (6S)-3-benzyl-5-(2-phenoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylate.
What is the SMILES notation for methyl (6S)-3-benzyl-5-(2-phenoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylate?
The canonical SMILES for methyl (6S)-3-benzyl-5-(2-phenoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylate is COC(=O)[C@@H]1Cc2ncn(Cc3ccccc3)c2CN1C(=O)COc1ccccc1.
What is the InChIKey of methyl (6S)-3-benzyl-5-(2-phenoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylate?
The InChIKey is DRULHSJGKMQNAA-FQEVSTJZSA-N. The full InChI is InChI=1S/C23H23N3O4/c1-29-23(28)20-12-19-21(25(16-24-19)13-17-8-4-2-5-9-17)14-26(20)22(27)15-30-18-10-6-3-7-11-18/h2-11,16,20H,12-15H2,1H3/t20-/m0/s1.
What are the key properties of methyl (6S)-3-benzyl-5-(2-phenoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylate?
methyl (6S)-3-benzyl-5-(2-phenoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylate has a molecular weight of 405.45 g/mol, XLogP of 2.44, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (6S)-3-benzyl-5-(2-phenoxyacetyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-6-carboxylate is sourced from PubChem (CID 25338966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).