C18H16N2O5 — CID 2533920
[2-(4-methylanilino)-2-oxoethyl] (E)-3-(2-nitrophenyl)prop-2-enoate (PubChem CID 2533920) has the molecular formula C18H16N2O5 and a molecular weight of 340.30 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] (E)-3-(2-nitrophenyl)prop-2-enoate.
| Compound Name | [2-(4-methylanilino)-2-oxoethyl] (E)-3-(2-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2533920 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl] (E)-3-(2-nitrophenyl)prop-2-enoate |
| SMILES | CC1=CC=C(C=C1)NC(=O)COC(=O)/C=C/C2=CC=CC=C2[N+](=O)[O-] |
| InChI | InChI=1S/C18H16N2O5/c1-13-6-9-15(10-7-13)19-17(21)12-25-18(22)11-8-14-4-2-3-5-16(14)20(23)24/h2-11H,12H2,1H3,(H,19,21)/b11-8+ |
| InChIKey | SMWMDODHKSMTRA-DHZHZOJOSA-N |
| XLogP | 3.30 |
| TPSA | 101.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | 506 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|