C26H41N3O5 — CID 25339569
N-[(1S,3aS,5S,7aR)-5-hydroxy-3,3,5-trimethyl-7a-[3-(2-morpholin-4-ylethylamino)-3-oxopropyl]-1,2,3a,4,6,7-hexahydroinden-1-yl]furan-2-carboxamide (PubChem CID 25339569) has the molecular formula C26H41N3O5 and a molecular weight of 475.63 g/mol. Its IUPAC name is N-[(1S,3aS,5S,7aR)-5-hydroxy-3,3,5-trimethyl-7a-[3-(2-morpholin-4-ylethylamino)-3-oxopropyl]-1,2,3a,4,6,7-hexahydroinden-1-yl]furan-2-carboxamide.
| Compound Name | N-[(1S,3aS,5S,7aR)-5-hydroxy-3,3,5-trimethyl-7a-[3-(2-morpholin-4-ylethylamino)-3-oxopropyl]-1,2,3a,4,6,7-hexahydroinden-1-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 25339569 |
| Molecular Formula | C26H41N3O5 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | N-[(1S,3aS,5S,7aR)-5-hydroxy-3,3,5-trimethyl-7a-[3-(2-morpholin-4-ylethylamino)-3-oxopropyl]-1,2,3a,4,6,7-hexahydroinden-1-yl]furan-2-carboxamide |
| SMILES | CC1(C)C[C@H](NC(=O)c2ccco2)[C@@]2(CCC(=O)NCCN3CCOCC3)CC[C@](C)(O)C[C@@H]12 |
| InChI | InChI=1S/C26H41N3O5/c1-24(2)18-21(28-23(31)19-5-4-14-34-19)26(9-8-25(3,32)17-20(24)26)7-6-22(30)27-10-11-29-12-15-33-16-13-29/h4-5,14,20-21,32H,6-13,15-18H2,1-3H3,(H,27,30)(H,28,31)/t20-,21-,25-,26-/m0/s1 |
| InChIKey | XILFXXXBDSLCQJ-KCXKOMAXSA-N |
| XLogP | 2.57 |
| TPSA | 104.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |