C30H39FN2O4 — CID 25339627
N-[(1S,3aS,5S,7aR)-5-hydroxy-7a-[3-[(4-methoxyphenyl)methylamino]-3-oxopropyl]-3,3,5-trimethyl-1,2,3a,4,6,7-hexahydroinden-1-yl]-3-fluorobenzamide (PubChem CID 25339627) has the molecular formula C30H39FN2O4 and a molecular weight of 510.65 g/mol. Its IUPAC name is N-[(1S,3aS,5S,7aR)-5-hydroxy-7a-[3-[(4-methoxyphenyl)methylamino]-3-oxopropyl]-3,3,5-trimethyl-1,2,3a,4,6,7-hexahydroinden-1-yl]-3-fluorobenzamide.
| Compound Name | N-[(1S,3aS,5S,7aR)-5-hydroxy-7a-[3-[(4-methoxyphenyl)methylamino]-3-oxopropyl]-3,3,5-trimethyl-1,2,3a,4,6,7-hexahydroinden-1-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 25339627 |
| Molecular Formula | C30H39FN2O4 |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | N-[(1S,3aS,5S,7aR)-5-hydroxy-7a-[3-[(4-methoxyphenyl)methylamino]-3-oxopropyl]-3,3,5-trimethyl-1,2,3a,4,6,7-hexahydroinden-1-yl]-3-fluorobenzamide |
| SMILES | COc1ccc(CNC(=O)CC[C@]23CC[C@](C)(O)C[C@H]2C(C)(C)C[C@@H]3NC(=O)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C30H39FN2O4/c1-28(2)18-25(33-27(35)21-6-5-7-22(31)16-21)30(15-14-29(3,36)17-24(28)30)13-12-26(34)32-19-20-8-10-23(37-4)11-9-20/h5-11,16,24-25,36H,12-15,17-19H2,1-4H3,(H,32,34)(H,33,35)/t24-,25-,29-,30-/m0/s1 |
| InChIKey | SBKHYYVYLPPJLO-RCYOKLDESA-N |
| XLogP | 5.00 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |