C28H44N2O4 — CID 25339648
3-[(3S,3aR,6S,7aS)-6-hydroxy-1,1,6-trimethyl-3-(oxan-4-ylamino)-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-[(4-methoxyphenyl)methyl]propanamide (PubChem CID 25339648) has the molecular formula C28H44N2O4 and a molecular weight of 472.67 g/mol. Its IUPAC name is 3-[(3S,3aR,6S,7aS)-6-hydroxy-1,1,6-trimethyl-3-(oxan-4-ylamino)-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-[(4-methoxyphenyl)methyl]propanamide.
| Compound Name | 3-[(3S,3aR,6S,7aS)-6-hydroxy-1,1,6-trimethyl-3-(oxan-4-ylamino)-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-[(4-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 25339648 |
| Molecular Formula | C28H44N2O4 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.33 |
| IUPAC Name | 3-[(3S,3aR,6S,7aS)-6-hydroxy-1,1,6-trimethyl-3-(oxan-4-ylamino)-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-[(4-methoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(CNC(=O)CC[C@]23CC[C@](C)(O)C[C@H]2C(C)(C)C[C@@H]3NC2CCOCC2)cc1 |
| InChI | InChI=1S/C28H44N2O4/c1-26(2)18-24(30-21-10-15-34-16-11-21)28(14-13-27(3,32)17-23(26)28)12-9-25(31)29-19-20-5-7-22(33-4)8-6-20/h5-8,21,23-24,30,32H,9-19H2,1-4H3,(H,29,31)/t23-,24-,27-,28-/m0/s1 |
| InChIKey | WDIYEOMOMINMGI-LSGCGUROSA-N |
| XLogP | 4.20 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |