C25H43N3O3 — CID 25339698
3-[(3S,3aR,6S,7aS)-3-[(1-acetylpiperidin-4-yl)amino]-6-hydroxy-1,1,6-trimethyl-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-cyclopropylpropanamide (PubChem CID 25339698) has the molecular formula C25H43N3O3 and a molecular weight of 433.64 g/mol. Its IUPAC name is 3-[(3S,3aR,6S,7aS)-3-[(1-acetylpiperidin-4-yl)amino]-6-hydroxy-1,1,6-trimethyl-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-cyclopropylpropanamide.
| Compound Name | 3-[(3S,3aR,6S,7aS)-3-[(1-acetylpiperidin-4-yl)amino]-6-hydroxy-1,1,6-trimethyl-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 25339698 |
| Molecular Formula | C25H43N3O3 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.33 |
| IUPAC Name | 3-[(3S,3aR,6S,7aS)-3-[(1-acetylpiperidin-4-yl)amino]-6-hydroxy-1,1,6-trimethyl-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-cyclopropylpropanamide |
| SMILES | CC(=O)N1CCC(N[C@H]2CC(C)(C)[C@@H]3C[C@@](C)(O)CC[C@]23CCC(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C25H43N3O3/c1-17(29)28-13-8-19(9-14-28)26-21-16-23(2,3)20-15-24(4,31)11-12-25(20,21)10-7-22(30)27-18-5-6-18/h18-21,26,31H,5-16H2,1-4H3,(H,27,30)/t20-,21-,24-,25-/m0/s1 |
| InChIKey | MLWSBOVMLLVXOE-NBMBROAQSA-N |
| XLogP | 2.98 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |