C21H22ClN5O3 — CID 25342878
5-[(1S)-1-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]ethyl]-3-(4-methylphenyl)-1,2,4-oxadiazole (PubChem CID 25342878) has the molecular formula C21H22ClN5O3 and a molecular weight of 427.89 g/mol. Its IUPAC name is 5-[(1S)-1-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]ethyl]-3-(4-methylphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[(1S)-1-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]ethyl]-3-(4-methylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 25342878 |
| Molecular Formula | C21H22ClN5O3 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 5-[(1S)-1-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]ethyl]-3-(4-methylphenyl)-1,2,4-oxadiazole |
| SMILES | Cc1ccc(-c2noc([C@H](C)N3CCN(c4ccc([N+](=O)[O-])cc4Cl)CC3)n2)cc1 |
| InChI | InChI=1S/C21H22ClN5O3/c1-14-3-5-16(6-4-14)20-23-21(30-24-20)15(2)25-9-11-26(12-10-25)19-8-7-17(27(28)29)13-18(19)22/h3-8,13,15H,9-12H2,1-2H3/t15-/m0/s1 |
| InChIKey | AGTCFBROPYPZJP-HNNXBMFYSA-N |
| XLogP | 4.49 |
| TPSA | 88.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|