C22H24N4O6 — CID 25343184
N-(2-methyl-5-nitrophenyl)-2-[(2S)-2-(morpholine-4-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]acetamide (PubChem CID 25343184) has the molecular formula C22H24N4O6 and a molecular weight of 440.46 g/mol. Its IUPAC name is N-(2-methyl-5-nitrophenyl)-2-[(2S)-2-(morpholine-4-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]acetamide.
| Compound Name | N-(2-methyl-5-nitrophenyl)-2-[(2S)-2-(morpholine-4-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]acetamide |
|---|---|
| PubChem CID | 25343184 |
| Molecular Formula | C22H24N4O6 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | N-(2-methyl-5-nitrophenyl)-2-[(2S)-2-(morpholine-4-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]acetamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)CN1C[C@@H](C(=O)N2CCOCC2)Oc2ccccc21 |
| InChI | InChI=1S/C22H24N4O6/c1-15-6-7-16(26(29)30)12-17(15)23-21(27)14-25-13-20(22(28)24-8-10-31-11-9-24)32-19-5-3-2-4-18(19)25/h2-7,12,20H,8-11,13-14H2,1H3,(H,23,27)/t20-/m0/s1 |
| InChIKey | IWVHYQCYFJXLIL-FQEVSTJZSA-N |
| XLogP | 1.97 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|