C21H25N5O2S2 — CID 25344346
2-[[5-(2-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(N-methylanilino)propyl]acetamide (PubChem CID 25344346) has the molecular formula C21H25N5O2S2 and a molecular weight of 443.60 g/mol. Its IUPAC name is 2-[[5-(2-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(N-methylanilino)propyl]acetamide.
| Compound Name | 2-[[5-(2-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(N-methylanilino)propyl]acetamide |
|---|---|
| PubChem CID | 25344346 |
| Molecular Formula | C21H25N5O2S2 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-[[5-(2-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(N-methylanilino)propyl]acetamide |
| SMILES | COc1ccccc1Nc1nnc(SCC(=O)NCCCN(C)c2ccccc2)s1 |
| InChI | InChI=1S/C21H25N5O2S2/c1-26(16-9-4-3-5-10-16)14-8-13-22-19(27)15-29-21-25-24-20(30-21)23-17-11-6-7-12-18(17)28-2/h3-7,9-12H,8,13-15H2,1-2H3,(H,22,27)(H,23,24) |
| InChIKey | LWWCPKHUCULCDI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|