C15H13FN6O — CID 25344863
N-(4-fluorophenyl)-2-[3-(tetrazol-1-yl)anilino]acetamide (PubChem CID 25344863) has the molecular formula C15H13FN6O and a molecular weight of 312.31 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[3-(tetrazol-1-yl)anilino]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[3-(tetrazol-1-yl)anilino]acetamide |
|---|---|
| PubChem CID | 25344863 |
| Molecular Formula | C15H13FN6O |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-(4-fluorophenyl)-2-[3-(tetrazol-1-yl)anilino]acetamide |
| SMILES | O=C(CNc1cccc(-n2cnnn2)c1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C15H13FN6O/c16-11-4-6-12(7-5-11)19-15(23)9-17-13-2-1-3-14(8-13)22-10-18-20-21-22/h1-8,10,17H,9H2,(H,19,23) |
| InChIKey | ZLHJUMSMYYNNRW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |