C21H19N3OS — CID 25346335
(3R)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-3-phenylbutanamide (PubChem CID 25346335) has the molecular formula C21H19N3OS and a molecular weight of 361.47 g/mol. Its IUPAC name is (3R)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-3-phenylbutanamide.
| Compound Name | (3R)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-3-phenylbutanamide |
|---|---|
| PubChem CID | 25346335 |
| Molecular Formula | C21H19N3OS |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (3R)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-3-phenylbutanamide |
| SMILES | C[C@H](CC(=O)Nc1ccc(-c2cn3ccsc3n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H19N3OS/c1-15(16-5-3-2-4-6-16)13-20(25)22-18-9-7-17(8-10-18)19-14-24-11-12-26-21(24)23-19/h2-12,14-15H,13H2,1H3,(H,22,25)/t15-/m1/s1 |
| InChIKey | HEVWUGLERSUYEX-OAHLLOKOSA-N |
| XLogP | 5.20 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |