C19H21FN4O2 — CID 25346781
(2R)-N-carbamoyl-2-[4-(2-fluorophenyl)piperazin-1-yl]-2-phenylacetamide (PubChem CID 25346781) has the molecular formula C19H21FN4O2 and a molecular weight of 356.40 g/mol. Its IUPAC name is (2R)-N-carbamoyl-2-[4-(2-fluorophenyl)piperazin-1-yl]-2-phenylacetamide.
| Compound Name | (2R)-N-carbamoyl-2-[4-(2-fluorophenyl)piperazin-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 25346781 |
| Molecular Formula | C19H21FN4O2 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (2R)-N-carbamoyl-2-[4-(2-fluorophenyl)piperazin-1-yl]-2-phenylacetamide |
| SMILES | NC(=O)NC(=O)[C@@H](c1ccccc1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C19H21FN4O2/c20-15-8-4-5-9-16(15)23-10-12-24(13-11-23)17(18(25)22-19(21)26)14-6-2-1-3-7-14/h1-9,17H,10-13H2,(H3,21,22,25,26)/t17-/m1/s1 |
| InChIKey | SUAUEFURIPIWDO-QGZVFWFLSA-N |
| XLogP | 1.88 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |