C24H28N4O6S — CID 25347097
(2R)-2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)propanamide (PubChem CID 25347097) has the molecular formula C24H28N4O6S and a molecular weight of 500.58 g/mol. Its IUPAC name is (2R)-2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)propanamide.
| Compound Name | (2R)-2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 25347097 |
| Molecular Formula | C24H28N4O6S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | (2R)-2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)[C@@H](C)N2C(=O)N[C@](C)(c3ccccc3)C2=O)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C24H28N4O6S/c1-16-9-10-19(15-20(16)35(32,33)27-11-13-34-14-12-27)25-21(29)17(2)28-22(30)24(3,26-23(28)31)18-7-5-4-6-8-18/h4-10,15,17H,11-14H2,1-3H3,(H,25,29)(H,26,31)/t17-,24-/m1/s1 |
| InChIKey | CHYGSXSTUUQGMM-MZNJEOGPSA-N |
| XLogP | 1.81 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|