About 3,5-dichloro-4-hydroxy-N-[4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-yl]benzamide
3,5-dichloro-4-hydroxy-N-[4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-yl]benzamide (PubChem CID 25348239) has the molecular formula C15H12Cl2N4O2S
and a molecular weight of 383.26 g/mol. Its IUPAC name is 3,5-dichloro-4-hydroxy-N-[4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-yl]benzamide.
Molecular Properties
| Compound Name | 3,5-dichloro-4-hydroxy-N-[4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-yl]benzamide |
| PubChem CID | 25348239 |
| Molecular Formula | C15H12Cl2N4O2S |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | 3,5-dichloro-4-hydroxy-N-[4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-yl]benzamide |
| SMILES | Cc1nc(NC(=O)c2cc(Cl)c(O)c(Cl)c2)sc1-c1nccn1C |
| InChI | InChI=1S/C15H12Cl2N4O2S/c1-7-12(13-18-3-4-21(13)2)24-15(19-7)20-14(23)8-5-9(16)11(22)10(17)6-8/h3-6,22H,1-2H3,(H,19,20,23) |
| InChIKey | ZTLHMPRXOQMGTL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3,5-dichloro-4-hydroxy-N-[4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-4-hydroxy-N-[4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-yl]benzamide?
The IUPAC name of 3,5-dichloro-4-hydroxy-N-[4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-yl]benzamide (CID 25348239) is 3,5-dichloro-4-hydroxy-N-[4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-yl]benzamide.
What is the SMILES notation for 3,5-dichloro-4-hydroxy-N-[4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-yl]benzamide?
The canonical SMILES for 3,5-dichloro-4-hydroxy-N-[4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-yl]benzamide is Cc1nc(NC(=O)c2cc(Cl)c(O)c(Cl)c2)sc1-c1nccn1C.
What is the InChIKey of 3,5-dichloro-4-hydroxy-N-[4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-yl]benzamide?
The InChIKey is ZTLHMPRXOQMGTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl2N4O2S/c1-7-12(13-18-3-4-21(13)2)24-15(19-7)20-14(23)8-5-9(16)11(22)10(17)6-8/h3-6,22H,1-2H3,(H,19,20,23).
What are the key properties of 3,5-dichloro-4-hydroxy-N-[4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-yl]benzamide?
3,5-dichloro-4-hydroxy-N-[4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-yl]benzamide has a molecular weight of 383.26 g/mol, XLogP of 4.12, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-4-hydroxy-N-[4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-yl]benzamide is sourced from PubChem (CID 25348239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).