C22H20N2O4S2 — CID 25348450
4-[(4-acetylphenyl)sulfonylamino]-N-(2-methylsulfanylphenyl)benzamide (PubChem CID 25348450) has the molecular formula C22H20N2O4S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 4-[(4-acetylphenyl)sulfonylamino]-N-(2-methylsulfanylphenyl)benzamide.
| Compound Name | 4-[(4-acetylphenyl)sulfonylamino]-N-(2-methylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 25348450 |
| Molecular Formula | C22H20N2O4S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 4-[(4-acetylphenyl)sulfonylamino]-N-(2-methylsulfanylphenyl)benzamide |
| SMILES | CSc1ccccc1NC(=O)c1ccc(NS(=O)(=O)c2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C22H20N2O4S2/c1-15(25)16-9-13-19(14-10-16)30(27,28)24-18-11-7-17(8-12-18)22(26)23-20-5-3-4-6-21(20)29-2/h3-14,24H,1-2H3,(H,23,26) |
| InChIKey | KISPGUARQIKEIW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |