C12H14N2O — CID 25348690
N-ethyl-1-methylindole-3-carboxamide (PubChem CID 25348690) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is N-ethyl-1-methylindole-3-carboxamide.
| Compound Name | N-ethyl-1-methylindole-3-carboxamide |
|---|---|
| PubChem CID | 25348690 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | N-ethyl-1-methylindole-3-carboxamide |
| SMILES | CCNC(=O)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C12H14N2O/c1-3-13-12(15)10-8-14(2)11-7-5-4-6-9(10)11/h4-8H,3H2,1-2H3,(H,13,15) |
| InChIKey | JBZKPXZYJHUZCI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |