C16H18N2O — CID 25348784
(2S)-2-(3,5-dimethylanilino)-2-phenylacetamide (PubChem CID 25348784) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is (2S)-2-(3,5-dimethylanilino)-2-phenylacetamide.
| Compound Name | (2S)-2-(3,5-dimethylanilino)-2-phenylacetamide |
|---|---|
| PubChem CID | 25348784 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | (2S)-2-(3,5-dimethylanilino)-2-phenylacetamide |
| SMILES | Cc1cc(C)cc(N[C@H](C(N)=O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H18N2O/c1-11-8-12(2)10-14(9-11)18-15(16(17)19)13-6-4-3-5-7-13/h3-10,15,18H,1-2H3,(H2,17,19)/t15-/m0/s1 |
| InChIKey | XKTCIERSNPKNCK-HNNXBMFYSA-N |
| XLogP | 2.94 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |