C19H31N3O5S — CID 25349046
5-(diethylsulfamoyl)-2-(2-methoxyethylamino)-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 25349046) has the molecular formula C19H31N3O5S and a molecular weight of 413.54 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-2-(2-methoxyethylamino)-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 5-(diethylsulfamoyl)-2-(2-methoxyethylamino)-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 25349046 |
| Molecular Formula | C19H31N3O5S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 5-(diethylsulfamoyl)-2-(2-methoxyethylamino)-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NCCOC)c(C(=O)NC[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C19H31N3O5S/c1-4-22(5-2)28(24,25)16-8-9-18(20-10-12-26-3)17(13-16)19(23)21-14-15-7-6-11-27-15/h8-9,13,15,20H,4-7,10-12,14H2,1-3H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | KFDWOLSSRGXVPI-HNNXBMFYSA-N |
| XLogP | 1.68 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|