C24H19N5OS — CID 25349299
2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[3-(2-pyridin-2-ylethynyl)phenyl]acetamide (PubChem CID 25349299) has the molecular formula C24H19N5OS and a molecular weight of 425.52 g/mol. Its IUPAC name is 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[3-(2-pyridin-2-ylethynyl)phenyl]acetamide.
| Compound Name | 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[3-(2-pyridin-2-ylethynyl)phenyl]acetamide |
|---|---|
| PubChem CID | 25349299 |
| Molecular Formula | C24H19N5OS |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[3-(2-pyridin-2-ylethynyl)phenyl]acetamide |
| SMILES | Cc1cccc(-c2n[nH]c(=S)n2CC(=O)Nc2cccc(C#Cc3ccccn3)c2)c1 |
| InChI | InChI=1S/C24H19N5OS/c1-17-6-4-8-19(14-17)23-27-28-24(31)29(23)16-22(30)26-21-10-5-7-18(15-21)11-12-20-9-2-3-13-25-20/h2-10,13-15H,16H2,1H3,(H,26,30)(H,28,31) |
| InChIKey | MZUMXMDOHOXEHA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|