C19H15F3N4OS — CID 25349578
4-(2,5-dimethylphenyl)-1-(2,2,2-trifluoroethylsulfanyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 25349578) has the molecular formula C19H15F3N4OS and a molecular weight of 404.42 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)-1-(2,2,2-trifluoroethylsulfanyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 4-(2,5-dimethylphenyl)-1-(2,2,2-trifluoroethylsulfanyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 25349578 |
| Molecular Formula | C19H15F3N4OS |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 4-(2,5-dimethylphenyl)-1-(2,2,2-trifluoroethylsulfanyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | Cc1ccc(C)c(-n2c(=O)c3ccccc3n3c(SCC(F)(F)F)nnc23)c1 |
| InChI | InChI=1S/C19H15F3N4OS/c1-11-7-8-12(2)15(9-11)25-16(27)13-5-3-4-6-14(13)26-17(25)23-24-18(26)28-10-19(20,21)22/h3-9H,10H2,1-2H3 |
| InChIKey | UDARQZIOXCABON-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |