C18H17ClN4O3 — CID 25352425
2-chloro-N-[(R)-(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-nitroaniline (PubChem CID 25352425) has the molecular formula C18H17ClN4O3 and a molecular weight of 372.81 g/mol. Its IUPAC name is 2-chloro-N-[(R)-(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-nitroaniline.
| Compound Name | 2-chloro-N-[(R)-(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-nitroaniline |
|---|---|
| PubChem CID | 25352425 |
| Molecular Formula | C18H17ClN4O3 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 2-chloro-N-[(R)-(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-nitroaniline |
| SMILES | COc1ccccc1[C@@H](Nc1ccc([N+](=O)[O-])cc1Cl)c1nccn1C |
| InChI | InChI=1S/C18H17ClN4O3/c1-22-10-9-20-18(22)17(13-5-3-4-6-16(13)26-2)21-15-8-7-12(23(24)25)11-14(15)19/h3-11,17,21H,1-2H3/t17-/m1/s1 |
| InChIKey | MESBMSDWHNALCB-QGZVFWFLSA-N |
| XLogP | 4.19 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|