C21H24N4O4S — CID 25353607
(2R)-2-[[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(dimethylamino)phenyl]propanamide (PubChem CID 25353607) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is (2R)-2-[[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(dimethylamino)phenyl]propanamide.
| Compound Name | (2R)-2-[[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(dimethylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 25353607 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | (2R)-2-[[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(dimethylamino)phenyl]propanamide |
| SMILES | COc1ccc(-c2nnc(S[C@H](C)C(=O)Nc3ccc(N(C)C)cc3)o2)c(OC)c1 |
| InChI | InChI=1S/C21H24N4O4S/c1-13(19(26)22-14-6-8-15(9-7-14)25(2)3)30-21-24-23-20(29-21)17-11-10-16(27-4)12-18(17)28-5/h6-13H,1-5H3,(H,22,26)/t13-/m1/s1 |
| InChIKey | SRUJUPKTJOJRTD-CYBMUJFWSA-N |
| XLogP | 3.94 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|