About (5-acetyl-2-methoxyphenyl)methyl 3,5-dimethyl-1,2-oxazole-4-carboxylate
(5-acetyl-2-methoxyphenyl)methyl 3,5-dimethyl-1,2-oxazole-4-carboxylate (PubChem CID 2535734) has the molecular formula C16H17NO5
and a molecular weight of 303.31 g/mol. Its IUPAC name is (5-acetyl-2-methoxyphenyl)methyl 3,5-dimethyl-1,2-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | (5-acetyl-2-methoxyphenyl)methyl 3,5-dimethyl-1,2-oxazole-4-carboxylate |
| PubChem CID | 2535734 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (5-acetyl-2-methoxyphenyl)methyl 3,5-dimethyl-1,2-oxazole-4-carboxylate |
| SMILES | COc1ccc(C(C)=O)cc1COC(=O)c1c(C)noc1C |
| InChI | InChI=1S/C16H17NO5/c1-9-15(11(3)22-17-9)16(19)21-8-13-7-12(10(2)18)5-6-14(13)20-4/h5-7H,8H2,1-4H3 |
| InChIKey | MVKGNLZDWGXTOF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5-acetyl-2-methoxyphenyl)methyl 3,5-dimethyl-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-acetyl-2-methoxyphenyl)methyl 3,5-dimethyl-1,2-oxazole-4-carboxylate?
The IUPAC name of (5-acetyl-2-methoxyphenyl)methyl 3,5-dimethyl-1,2-oxazole-4-carboxylate (CID 2535734) is (5-acetyl-2-methoxyphenyl)methyl 3,5-dimethyl-1,2-oxazole-4-carboxylate.
What is the SMILES notation for (5-acetyl-2-methoxyphenyl)methyl 3,5-dimethyl-1,2-oxazole-4-carboxylate?
The canonical SMILES for (5-acetyl-2-methoxyphenyl)methyl 3,5-dimethyl-1,2-oxazole-4-carboxylate is COc1ccc(C(C)=O)cc1COC(=O)c1c(C)noc1C.
What is the InChIKey of (5-acetyl-2-methoxyphenyl)methyl 3,5-dimethyl-1,2-oxazole-4-carboxylate?
The InChIKey is MVKGNLZDWGXTOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO5/c1-9-15(11(3)22-17-9)16(19)21-8-13-7-12(10(2)18)5-6-14(13)20-4/h5-7H,8H2,1-4H3.
What are the key properties of (5-acetyl-2-methoxyphenyl)methyl 3,5-dimethyl-1,2-oxazole-4-carboxylate?
(5-acetyl-2-methoxyphenyl)methyl 3,5-dimethyl-1,2-oxazole-4-carboxylate has a molecular weight of 303.31 g/mol, XLogP of 2.86, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-acetyl-2-methoxyphenyl)methyl 3,5-dimethyl-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 2535734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).