C22H30N4O7S — CID 25361418
N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2-[(5R,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 25361418) has the molecular formula C22H30N4O7S and a molecular weight of 494.57 g/mol. Its IUPAC name is N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2-[(5R,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2-[(5R,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 25361418 |
| Molecular Formula | C22H30N4O7S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2-[(5R,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)CN1C(=O)N[C@@]2(CCCC[C@@H]2C)C1=O |
| InChI | InChI=1S/C22H30N4O7S/c1-15-5-3-4-8-22(15)20(28)26(21(29)24-22)14-19(27)23-17-13-16(6-7-18(17)32-2)34(30,31)25-9-11-33-12-10-25/h6-7,13,15H,3-5,8-12,14H2,1-2H3,(H,23,27)(H,24,29)/t15-,22+/m0/s1 |
| InChIKey | NGGGRCIZLYDFTH-OYHNWAKOSA-N |
| XLogP | 1.16 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|