C26H29N3O2 — CID 25362284
(2S)-N-(3-methoxyphenyl)-2-phenyl-2-(4-piperidin-1-ylanilino)acetamide (PubChem CID 25362284) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is (2S)-N-(3-methoxyphenyl)-2-phenyl-2-(4-piperidin-1-ylanilino)acetamide.
| Compound Name | (2S)-N-(3-methoxyphenyl)-2-phenyl-2-(4-piperidin-1-ylanilino)acetamide |
|---|---|
| PubChem CID | 25362284 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | (2S)-N-(3-methoxyphenyl)-2-phenyl-2-(4-piperidin-1-ylanilino)acetamide |
| SMILES | COc1cccc(NC(=O)[C@@H](Nc2ccc(N3CCCCC3)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C26H29N3O2/c1-31-24-12-8-11-22(19-24)28-26(30)25(20-9-4-2-5-10-20)27-21-13-15-23(16-14-21)29-17-6-3-7-18-29/h2,4-5,8-16,19,25,27H,3,6-7,17-18H2,1H3,(H,28,30)/t25-/m0/s1 |
| InChIKey | YETDZRNSLBENJQ-VWLOTQADSA-N |
| XLogP | 5.48 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|