C20H18N4O5S — CID 25362620
1-[2-[(4R)-4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl]-2-oxoethyl]-3-(thiophen-2-ylmethyl)imidazolidine-2,4,5-trione (PubChem CID 25362620) has the molecular formula C20H18N4O5S and a molecular weight of 426.45 g/mol. Its IUPAC name is 1-[2-[(4R)-4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl]-2-oxoethyl]-3-(thiophen-2-ylmethyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[2-[(4R)-4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl]-2-oxoethyl]-3-(thiophen-2-ylmethyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 25362620 |
| Molecular Formula | C20H18N4O5S |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 1-[2-[(4R)-4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl]-2-oxoethyl]-3-(thiophen-2-ylmethyl)imidazolidine-2,4,5-trione |
| SMILES | C[C@@H]1CC(=O)Nc2ccccc2N1C(=O)CN1C(=O)C(=O)N(Cc2cccs2)C1=O |
| InChI | InChI=1S/C20H18N4O5S/c1-12-9-16(25)21-14-6-2-3-7-15(14)24(12)17(26)11-23-19(28)18(27)22(20(23)29)10-13-5-4-8-30-13/h2-8,12H,9-11H2,1H3,(H,21,25)/t12-/m1/s1 |
| InChIKey | YGYRXVFNZUVUDK-GFCCVEGCSA-N |
| XLogP | 1.80 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|