About 2-[(2,4-dichlorophenyl)methyl-methylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide
2-[(2,4-dichlorophenyl)methyl-methylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 2536589) has the molecular formula C18H21Cl2N3O3S
and a molecular weight of 430.36 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl-methylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-[(2,4-dichlorophenyl)methyl-methylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| PubChem CID | 2536589 |
| Molecular Formula | C18H21Cl2N3O3S |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl-methylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | CN(CC(=O)NCCc1ccc(S(N)(=O)=O)cc1)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H21Cl2N3O3S/c1-23(11-14-4-5-15(19)10-17(14)20)12-18(24)22-9-8-13-2-6-16(7-3-13)27(21,25)26/h2-7,10H,8-9,11-12H2,1H3,(H,22,24)(H2,21,25,26) |
| InChIKey | RYVBEPFPNHAENK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2,4-dichlorophenyl)methyl-methylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-dichlorophenyl)methyl-methylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide?
The IUPAC name of 2-[(2,4-dichlorophenyl)methyl-methylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (CID 2536589) is 2-[(2,4-dichlorophenyl)methyl-methylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
What is the SMILES notation for 2-[(2,4-dichlorophenyl)methyl-methylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide?
The canonical SMILES for 2-[(2,4-dichlorophenyl)methyl-methylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide is CN(CC(=O)NCCc1ccc(S(N)(=O)=O)cc1)Cc1ccc(Cl)cc1Cl.
What is the InChIKey of 2-[(2,4-dichlorophenyl)methyl-methylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide?
The InChIKey is RYVBEPFPNHAENK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21Cl2N3O3S/c1-23(11-14-4-5-15(19)10-17(14)20)12-18(24)22-9-8-13-2-6-16(7-3-13)27(21,25)26/h2-7,10H,8-9,11-12H2,1H3,(H,22,24)(H2,21,25,26).
What are the key properties of 2-[(2,4-dichlorophenyl)methyl-methylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide?
2-[(2,4-dichlorophenyl)methyl-methylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide has a molecular weight of 430.36 g/mol, XLogP of 2.43, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dichlorophenyl)methyl-methylamino]-N-[2-(4-sulfamoylphenyl)ethyl]acetamide is sourced from PubChem (CID 2536589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).