C20H20BrN3O2 — CID 25366205
2-(2-bromo-4-methylphenoxy)-N-[(1R)-1-(4-imidazol-1-ylphenyl)ethyl]acetamide (PubChem CID 25366205) has the molecular formula C20H20BrN3O2 and a molecular weight of 414.30 g/mol. Its IUPAC name is 2-(2-bromo-4-methylphenoxy)-N-[(1R)-1-(4-imidazol-1-ylphenyl)ethyl]acetamide.
| Compound Name | 2-(2-bromo-4-methylphenoxy)-N-[(1R)-1-(4-imidazol-1-ylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 25366205 |
| Molecular Formula | C20H20BrN3O2 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 2-(2-bromo-4-methylphenoxy)-N-[(1R)-1-(4-imidazol-1-ylphenyl)ethyl]acetamide |
| SMILES | Cc1ccc(OCC(=O)N[C@H](C)c2ccc(-n3ccnc3)cc2)c(Br)c1 |
| InChI | InChI=1S/C20H20BrN3O2/c1-14-3-8-19(18(21)11-14)26-12-20(25)23-15(2)16-4-6-17(7-5-16)24-10-9-22-13-24/h3-11,13,15H,12H2,1-2H3,(H,23,25)/t15-/m1/s1 |
| InChIKey | PPNARCGDZJFDBX-OAHLLOKOSA-N |
| XLogP | 4.20 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |