C19H18FN3O2 — CID 25367645
2-(2-fluorophenoxy)-N-[(R)-(1-methylimidazol-2-yl)-phenylmethyl]acetamide (PubChem CID 25367645) has the molecular formula C19H18FN3O2 and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N-[(R)-(1-methylimidazol-2-yl)-phenylmethyl]acetamide.
| Compound Name | 2-(2-fluorophenoxy)-N-[(R)-(1-methylimidazol-2-yl)-phenylmethyl]acetamide |
|---|---|
| PubChem CID | 25367645 |
| Molecular Formula | C19H18FN3O2 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 2-(2-fluorophenoxy)-N-[(R)-(1-methylimidazol-2-yl)-phenylmethyl]acetamide |
| SMILES | Cn1ccnc1[C@H](NC(=O)COc1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C19H18FN3O2/c1-23-12-11-21-19(23)18(14-7-3-2-4-8-14)22-17(24)13-25-16-10-6-5-9-15(16)20/h2-12,18H,13H2,1H3,(H,22,24)/t18-/m1/s1 |
| InChIKey | GOMZGCADWRLRGM-GOSISDBHSA-N |
| XLogP | 2.84 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |