About [2-(naphthalen-2-ylamino)-2-oxoethyl] 2,4-dihydroxybenzoate
[2-(naphthalen-2-ylamino)-2-oxoethyl] 2,4-dihydroxybenzoate (PubChem CID 2536819) has the molecular formula C19H15NO5
and a molecular weight of 337.33 g/mol. Its IUPAC name is [2-(naphthalen-2-ylamino)-2-oxoethyl] 2,4-dihydroxybenzoate.
Molecular Properties
| Compound Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 2,4-dihydroxybenzoate |
| PubChem CID | 2536819 |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 2,4-dihydroxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(O)cc1O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H15NO5/c21-15-7-8-16(17(22)10-15)19(24)25-11-18(23)20-14-6-5-12-3-1-2-4-13(12)9-14/h1-10,21-22H,11H2,(H,20,23) |
| InChIKey | YPVJZNXMDDHMAP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(naphthalen-2-ylamino)-2-oxoethyl] 2,4-dihydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(naphthalen-2-ylamino)-2-oxoethyl] 2,4-dihydroxybenzoate?
The IUPAC name of [2-(naphthalen-2-ylamino)-2-oxoethyl] 2,4-dihydroxybenzoate (CID 2536819) is [2-(naphthalen-2-ylamino)-2-oxoethyl] 2,4-dihydroxybenzoate.
What is the SMILES notation for [2-(naphthalen-2-ylamino)-2-oxoethyl] 2,4-dihydroxybenzoate?
The canonical SMILES for [2-(naphthalen-2-ylamino)-2-oxoethyl] 2,4-dihydroxybenzoate is O=C(COC(=O)c1ccc(O)cc1O)Nc1ccc2ccccc2c1.
What is the InChIKey of [2-(naphthalen-2-ylamino)-2-oxoethyl] 2,4-dihydroxybenzoate?
The InChIKey is YPVJZNXMDDHMAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO5/c21-15-7-8-16(17(22)10-15)19(24)25-11-18(23)20-14-6-5-12-3-1-2-4-13(12)9-14/h1-10,21-22H,11H2,(H,20,23).
What are the key properties of [2-(naphthalen-2-ylamino)-2-oxoethyl] 2,4-dihydroxybenzoate?
[2-(naphthalen-2-ylamino)-2-oxoethyl] 2,4-dihydroxybenzoate has a molecular weight of 337.33 g/mol, XLogP of 3.05, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(naphthalen-2-ylamino)-2-oxoethyl] 2,4-dihydroxybenzoate is sourced from PubChem (CID 2536819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).