C21H27N2O+ — CID 2536830
cyclohexyl-methyl-[2-oxo-2-(4-phenylanilino)ethyl]azanium (PubChem CID 2536830) has the molecular formula C21H27N2O+ and a molecular weight of 323.46 g/mol. Its IUPAC name is cyclohexyl-methyl-[2-oxo-2-(4-phenylanilino)ethyl]azanium.
| Compound Name | cyclohexyl-methyl-[2-oxo-2-(4-phenylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 2536830 |
| Molecular Formula | C21H27N2O+ |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | cyclohexyl-methyl-[2-oxo-2-(4-phenylanilino)ethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(-c2ccccc2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C21H26N2O/c1-23(20-10-6-3-7-11-20)16-21(24)22-19-14-12-18(13-15-19)17-8-4-2-5-9-17/h2,4-5,8-9,12-15,20H,3,6-7,10-11,16H2,1H3,(H,22,24)/p+1 |
| InChIKey | XGMXBPVTZFGGRJ-UHFFFAOYSA-O |
| XLogP | 3.14 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |