C17H16BrNO4S2 — CID 25371812
ethyl 2-[(1S,10R)-4-bromo-15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraen-14-yl]acetate (PubChem CID 25371812) has the molecular formula C17H16BrNO4S2 and a molecular weight of 442.36 g/mol. Its IUPAC name is ethyl 2-[(1S,10R)-4-bromo-15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraen-14-yl]acetate.
| Compound Name | ethyl 2-[(1S,10R)-4-bromo-15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraen-14-yl]acetate |
|---|---|
| PubChem CID | 25371812 |
| Molecular Formula | C17H16BrNO4S2 |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 440.97 |
| IUPAC Name | ethyl 2-[(1S,10R)-4-bromo-15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraen-14-yl]acetate |
| SMILES | CCOC(=O)Cn1c2c(sc1=O)[C@@H]1c3cc(Br)ccc3OC[C@@H]1CS2 |
| InChI | InChI=1S/C17H16BrNO4S2/c1-2-22-13(20)6-19-16-15(25-17(19)21)14-9(8-24-16)7-23-12-4-3-10(18)5-11(12)14/h3-5,9,14H,2,6-8H2,1H3/t9-,14+/m1/s1 |
| InChIKey | GJXYOCBBBFAEQO-OTYXRUKQSA-N |
| XLogP | 3.48 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|