About N-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-5-methylthiophene-2-carboxamide
N-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-5-methylthiophene-2-carboxamide (PubChem CID 2537535) has the molecular formula C18H22N2O4S
and a molecular weight of 362.45 g/mol. Its IUPAC name is N-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-5-methylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-5-methylthiophene-2-carboxamide |
| PubChem CID | 2537535 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-5-methylthiophene-2-carboxamide |
| SMILES | COc1ccc(CCNC(=O)CNC(=O)c2ccc(C)s2)cc1OC |
| InChI | InChI=1S/C18H22N2O4S/c1-12-4-7-16(25-12)18(22)20-11-17(21)19-9-8-13-5-6-14(23-2)15(10-13)24-3/h4-7,10H,8-9,11H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | IZENEEXKHSGBIG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-5-methylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-5-methylthiophene-2-carboxamide?
The IUPAC name of N-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-5-methylthiophene-2-carboxamide (CID 2537535) is N-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-5-methylthiophene-2-carboxamide.
What is the SMILES notation for N-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-5-methylthiophene-2-carboxamide?
The canonical SMILES for N-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-5-methylthiophene-2-carboxamide is COc1ccc(CCNC(=O)CNC(=O)c2ccc(C)s2)cc1OC.
What is the InChIKey of N-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-5-methylthiophene-2-carboxamide?
The InChIKey is IZENEEXKHSGBIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O4S/c1-12-4-7-16(25-12)18(22)20-11-17(21)19-9-8-13-5-6-14(23-2)15(10-13)24-3/h4-7,10H,8-9,11H2,1-3H3,(H,19,21)(H,20,22).
What are the key properties of N-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-5-methylthiophene-2-carboxamide?
N-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-5-methylthiophene-2-carboxamide has a molecular weight of 362.45 g/mol, XLogP of 2.16, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-5-methylthiophene-2-carboxamide is sourced from PubChem (CID 2537535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).