About 2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanol
2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanol (PubChem CID 2537688) has the molecular formula C12H16N4OS
and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanol |
| PubChem CID | 2537688 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanol |
| SMILES | OCCN1CCN(c2ncnc3sccc23)CC1 |
| InChI | InChI=1S/C12H16N4OS/c17-7-6-15-2-4-16(5-3-15)11-10-1-8-18-12(10)14-9-13-11/h1,8-9,17H,2-7H2 |
| InChIKey | RMZULTRHWHVHDS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanol?
The IUPAC name of 2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanol (CID 2537688) is 2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanol.
What is the SMILES notation for 2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanol?
The canonical SMILES for 2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanol is OCCN1CCN(c2ncnc3sccc23)CC1.
What is the InChIKey of 2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanol?
The InChIKey is RMZULTRHWHVHDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4OS/c17-7-6-15-2-4-16(5-3-15)11-10-1-8-18-12(10)14-9-13-11/h1,8-9,17H,2-7H2.
What are the key properties of 2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanol?
2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanol has a molecular weight of 264.35 g/mol, XLogP of 0.81, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanol is sourced from PubChem (CID 2537688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).