C19H25ClFN3O2 — CID 25377635
(3R)-3-[2-(azepan-1-yl)-2-oxoethyl]-4-[(2-chloro-4-fluorophenyl)methyl]piperazin-2-one (PubChem CID 25377635) has the molecular formula C19H25ClFN3O2 and a molecular weight of 381.88 g/mol. Its IUPAC name is (3R)-3-[2-(azepan-1-yl)-2-oxoethyl]-4-[(2-chloro-4-fluorophenyl)methyl]piperazin-2-one.
| Compound Name | (3R)-3-[2-(azepan-1-yl)-2-oxoethyl]-4-[(2-chloro-4-fluorophenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 25377635 |
| Molecular Formula | C19H25ClFN3O2 |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (3R)-3-[2-(azepan-1-yl)-2-oxoethyl]-4-[(2-chloro-4-fluorophenyl)methyl]piperazin-2-one |
| SMILES | O=C1NCCN(Cc2ccc(F)cc2Cl)[C@@H]1CC(=O)N1CCCCCC1 |
| InChI | InChI=1S/C19H25ClFN3O2/c20-16-11-15(21)6-5-14(16)13-24-10-7-22-19(26)17(24)12-18(25)23-8-3-1-2-4-9-23/h5-6,11,17H,1-4,7-10,12-13H2,(H,22,26)/t17-/m1/s1 |
| InChIKey | ZMQYUZWHZFHPPV-QGZVFWFLSA-N |
| XLogP | 2.57 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |