About [(2S)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(3-phenoxyphenyl)methanone
[(2S)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(3-phenoxyphenyl)methanone (PubChem CID 25378300) has the molecular formula C24H20N2O2S
and a molecular weight of 400.50 g/mol. Its IUPAC name is [(2S)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(3-phenoxyphenyl)methanone.
Molecular Properties
| Compound Name | [(2S)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(3-phenoxyphenyl)methanone |
| PubChem CID | 25378300 |
| Molecular Formula | C24H20N2O2S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [(2S)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(3-phenoxyphenyl)methanone |
| SMILES | O=C(c1cccc(Oc2ccccc2)c1)N1CCC[C@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H20N2O2S/c27-24(17-8-6-11-19(16-17)28-18-9-2-1-3-10-18)26-15-7-13-21(26)23-25-20-12-4-5-14-22(20)29-23/h1-6,8-12,14,16,21H,7,13,15H2/t21-/m0/s1 |
| InChIKey | JPENSNKKTSBOHD-NRFANRHFSA-N |
| XLogP | 6.07 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(3-phenoxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(3-phenoxyphenyl)methanone?
The IUPAC name of [(2S)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(3-phenoxyphenyl)methanone (CID 25378300) is [(2S)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(3-phenoxyphenyl)methanone.
What is the SMILES notation for [(2S)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(3-phenoxyphenyl)methanone?
The canonical SMILES for [(2S)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(3-phenoxyphenyl)methanone is O=C(c1cccc(Oc2ccccc2)c1)N1CCC[C@H]1c1nc2ccccc2s1.
What is the InChIKey of [(2S)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(3-phenoxyphenyl)methanone?
The InChIKey is JPENSNKKTSBOHD-NRFANRHFSA-N. The full InChI is InChI=1S/C24H20N2O2S/c27-24(17-8-6-11-19(16-17)28-18-9-2-1-3-10-18)26-15-7-13-21(26)23-25-20-12-4-5-14-22(20)29-23/h1-6,8-12,14,16,21H,7,13,15H2/t21-/m0/s1.
What are the key properties of [(2S)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(3-phenoxyphenyl)methanone?
[(2S)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(3-phenoxyphenyl)methanone has a molecular weight of 400.50 g/mol, XLogP of 6.07, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-(3-phenoxyphenyl)methanone is sourced from PubChem (CID 25378300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).