C22H26N6O3 — CID 25378925
1,3-dimethyl-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 25378925) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is 1,3-dimethyl-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 1,3-dimethyl-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 25378925 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 1,3-dimethyl-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1cc(N2CCN(C)CC2)ccc1NC(=O)c1cnc2c(c1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C22H26N6O3/c1-14-11-16(28-9-7-25(2)8-10-28)5-6-18(14)24-20(29)15-12-17-19(23-13-15)26(3)22(31)27(4)21(17)30/h5-6,11-13H,7-10H2,1-4H3,(H,24,29) |
| InChIKey | VYMZYQHKKXDKTD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|