About 5-[(4-chloro-3,5-dimethylphenoxy)methyl]-N-(2-methylsulfanylethyl)-1,2-oxazole-3-carboxamide
5-[(4-chloro-3,5-dimethylphenoxy)methyl]-N-(2-methylsulfanylethyl)-1,2-oxazole-3-carboxamide (PubChem CID 25381337) has the molecular formula C16H19ClN2O3S
and a molecular weight of 354.86 g/mol. Its IUPAC name is 5-[(4-chloro-3,5-dimethylphenoxy)methyl]-N-(2-methylsulfanylethyl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-[(4-chloro-3,5-dimethylphenoxy)methyl]-N-(2-methylsulfanylethyl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 25381337 |
| Molecular Formula | C16H19ClN2O3S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 5-[(4-chloro-3,5-dimethylphenoxy)methyl]-N-(2-methylsulfanylethyl)-1,2-oxazole-3-carboxamide |
| SMILES | CSCCNC(=O)c1cc(COc2cc(C)c(Cl)c(C)c2)on1 |
| InChI | InChI=1S/C16H19ClN2O3S/c1-10-6-12(7-11(2)15(10)17)21-9-13-8-14(19-22-13)16(20)18-4-5-23-3/h6-8H,4-5,9H2,1-3H3,(H,18,20) |
| InChIKey | KQFANVLARNFGGG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[(4-chloro-3,5-dimethylphenoxy)methyl]-N-(2-methylsulfanylethyl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-chloro-3,5-dimethylphenoxy)methyl]-N-(2-methylsulfanylethyl)-1,2-oxazole-3-carboxamide?
The IUPAC name of 5-[(4-chloro-3,5-dimethylphenoxy)methyl]-N-(2-methylsulfanylethyl)-1,2-oxazole-3-carboxamide (CID 25381337) is 5-[(4-chloro-3,5-dimethylphenoxy)methyl]-N-(2-methylsulfanylethyl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 5-[(4-chloro-3,5-dimethylphenoxy)methyl]-N-(2-methylsulfanylethyl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for 5-[(4-chloro-3,5-dimethylphenoxy)methyl]-N-(2-methylsulfanylethyl)-1,2-oxazole-3-carboxamide is CSCCNC(=O)c1cc(COc2cc(C)c(Cl)c(C)c2)on1.
What is the InChIKey of 5-[(4-chloro-3,5-dimethylphenoxy)methyl]-N-(2-methylsulfanylethyl)-1,2-oxazole-3-carboxamide?
The InChIKey is KQFANVLARNFGGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN2O3S/c1-10-6-12(7-11(2)15(10)17)21-9-13-8-14(19-22-13)16(20)18-4-5-23-3/h6-8H,4-5,9H2,1-3H3,(H,18,20).
What are the key properties of 5-[(4-chloro-3,5-dimethylphenoxy)methyl]-N-(2-methylsulfanylethyl)-1,2-oxazole-3-carboxamide?
5-[(4-chloro-3,5-dimethylphenoxy)methyl]-N-(2-methylsulfanylethyl)-1,2-oxazole-3-carboxamide has a molecular weight of 354.86 g/mol, XLogP of 3.62, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-chloro-3,5-dimethylphenoxy)methyl]-N-(2-methylsulfanylethyl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 25381337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).