C21H25N — CID 25382
3-(10,10-dimethylanthracen-9-ylidene)-N,N-dimethylpropan-1-amine (PubChem CID 25382) has the molecular formula C21H25N and a molecular weight of 291.44 g/mol. Its IUPAC name is 3-(10,10-dimethylanthracen-9-ylidene)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(10,10-dimethylanthracen-9-ylidene)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 25382 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 3-(10,10-dimethylanthracen-9-ylidene)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCC=C1c2ccccc2C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C21H25N/c1-21(2)19-13-7-5-10-17(19)16(12-9-15-22(3)4)18-11-6-8-14-20(18)21/h5-8,10-14H,9,15H2,1-4H3 |
| InChIKey | GWWLWDURRGNSRS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'} |
|---|