C27H27ClN4O5S2 — CID 2538371
2-[(3-piperidin-1-ylsulfonylbenzoyl)amino]ethyl 1-(4-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate (PubChem CID 2538371) has the molecular formula C27H27ClN4O5S2 and a molecular weight of 587.12 g/mol. Its IUPAC name is 2-[(3-piperidin-1-ylsulfonylbenzoyl)amino]ethyl 1-(4-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate.
| Compound Name | 2-[(3-piperidin-1-ylsulfonylbenzoyl)amino]ethyl 1-(4-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 2538371 |
| Molecular Formula | C27H27ClN4O5S2 |
| Molecular Weight | 587.12 g/mol |
| Exact Mass | 586.11 |
| IUPAC Name | 2-[(3-piperidin-1-ylsulfonylbenzoyl)amino]ethyl 1-(4-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)c2sc(C(=O)OCCNC(=O)c3cccc(S(=O)(=O)N4CCCCC4)c3)cc12 |
| InChI | InChI=1S/C27H27ClN4O5S2/c1-18-23-17-24(38-26(23)32(30-18)21-10-8-20(28)9-11-21)27(34)37-15-12-29-25(33)19-6-5-7-22(16-19)39(35,36)31-13-3-2-4-14-31/h5-11,16-17H,2-4,12-15H2,1H3,(H,29,33) |
| InChIKey | ZYNBLGNXZJSFLH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.12 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|