C18H33N3O3 — CID 25384080
ethyl 3-[[(3R)-1-cycloheptylpiperidin-3-yl]carbamoylamino]propanoate (PubChem CID 25384080) has the molecular formula C18H33N3O3 and a molecular weight of 339.48 g/mol. Its IUPAC name is ethyl 3-[[(3R)-1-cycloheptylpiperidin-3-yl]carbamoylamino]propanoate.
| Compound Name | ethyl 3-[[(3R)-1-cycloheptylpiperidin-3-yl]carbamoylamino]propanoate |
|---|---|
| PubChem CID | 25384080 |
| Molecular Formula | C18H33N3O3 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | ethyl 3-[[(3R)-1-cycloheptylpiperidin-3-yl]carbamoylamino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)N[C@@H]1CCCN(C2CCCCCC2)C1 |
| InChI | InChI=1S/C18H33N3O3/c1-2-24-17(22)11-12-19-18(23)20-15-8-7-13-21(14-15)16-9-5-3-4-6-10-16/h15-16H,2-14H2,1H3,(H2,19,20,23)/t15-/m1/s1 |
| InChIKey | MGCNXSBKMICBOA-OAHLLOKOSA-N |
| XLogP | 2.43 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |