C20H24N2O3 — CID 25384402
(2R)-2-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-2-phenylacetamide (PubChem CID 25384402) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is (2R)-2-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-2-phenylacetamide.
| Compound Name | (2R)-2-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 25384402 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (2R)-2-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-2-phenylacetamide |
| SMILES | COc1ccc(OC)c([C@H]2CCCN2[C@@H](C(N)=O)c2ccccc2)c1 |
| InChI | InChI=1S/C20H24N2O3/c1-24-15-10-11-18(25-2)16(13-15)17-9-6-12-22(17)19(20(21)23)14-7-4-3-5-8-14/h3-5,7-8,10-11,13,17,19H,6,9,12H2,1-2H3,(H2,21,23)/t17-,19-/m1/s1 |
| InChIKey | KHJLLFDCKFMUQG-IEBWSBKVSA-N |
| XLogP | 3.07 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |