C11H9ClN4OS2 — CID 2538522
(5E)-5-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 2538522) has the molecular formula C11H9ClN4OS2 and a molecular weight of 312.81 g/mol. Its IUPAC name is (5E)-5-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 2538522 |
| Molecular Formula | C11H9ClN4OS2 |
| Molecular Weight | 312.81 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | (5E)-5-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=O)/C(=C\c2c(Cl)nc3sccn23)N(C)C1=S |
| InChI | InChI=1S/C11H9ClN4OS2/c1-14-7(9(17)15(2)11(14)18)5-6-8(12)13-10-16(6)3-4-19-10/h3-5H,1-2H3/b7-5+ |
| InChIKey | KFTUJXFWPOWMLR-FNORWQNLSA-N |
| XLogP | 2.08 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.81 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|