C20H17N3O3S3 — CID 2538595
N-[(6S)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetamide (PubChem CID 2538595) has the molecular formula C20H17N3O3S3 and a molecular weight of 443.58 g/mol. Its IUPAC name is N-[(6S)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-[(6S)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 2538595 |
| Molecular Formula | C20H17N3O3S3 |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | N-[(6S)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetamide |
| SMILES | C[C@H]1CCc2c(sc(NC(=O)CN3C(=O)S/C(=C\c4cccs4)C3=O)c2C#N)C1 |
| InChI | InChI=1S/C20H17N3O3S3/c1-11-4-5-13-14(9-21)18(28-15(13)7-11)22-17(24)10-23-19(25)16(29-20(23)26)8-12-3-2-6-27-12/h2-3,6,8,11H,4-5,7,10H2,1H3,(H,22,24)/b16-8-/t11-/m0/s1 |
| InChIKey | VPLIKFVVQHHHFH-FSKGUYTJSA-N |
| XLogP | 4.48 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|