C20H33N3O3 — CID 25388927
(3S)-N'-(cyclohexanecarbonyl)-1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-5-oxopyrrolidine-3-carbohydrazide (PubChem CID 25388927) has the molecular formula C20H33N3O3 and a molecular weight of 363.50 g/mol. Its IUPAC name is (3S)-N'-(cyclohexanecarbonyl)-1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-5-oxopyrrolidine-3-carbohydrazide.
| Compound Name | (3S)-N'-(cyclohexanecarbonyl)-1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-5-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 25388927 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | (3S)-N'-(cyclohexanecarbonyl)-1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-5-oxopyrrolidine-3-carbohydrazide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1N1C[C@@H](C(=O)NNC(=O)C2CCCCC2)CC1=O |
| InChI | InChI=1S/C20H33N3O3/c1-13-7-6-10-17(14(13)2)23-12-16(11-18(23)24)20(26)22-21-19(25)15-8-4-3-5-9-15/h13-17H,3-12H2,1-2H3,(H,21,25)(H,22,26)/t13-,14-,16+,17+/m1/s1 |
| InChIKey | LBDSDISCHJNTGW-JHNDHUHGSA-N |
| XLogP | 2.39 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|