C12H20N2O — CID 25389115
N-[[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]acetamide (PubChem CID 25389115) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is N-[[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]acetamide.
| Compound Name | N-[[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 25389115 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N-[[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]acetamide |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2CNC(C)=O |
| InChI | InChI=1S/C12H20N2O/c1-3-10-8-14-5-4-11(10)6-12(14)7-13-9(2)15/h3,10-12H,1,4-8H2,2H3,(H,13,15)/t10-,11-,12+/m0/s1 |
| InChIKey | QKQVHUWVRAPPGY-SDDRHHMPSA-N |
| XLogP | 1.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|