C18H34N4OS — CID 25389345
1-(2-methoxyethyl)-3-[[(2R,4S,5S)-5-(piperidin-1-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea (PubChem CID 25389345) has the molecular formula C18H34N4OS and a molecular weight of 354.56 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[[(2R,4S,5S)-5-(piperidin-1-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea.
| Compound Name | 1-(2-methoxyethyl)-3-[[(2R,4S,5S)-5-(piperidin-1-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 25389345 |
| Molecular Formula | C18H34N4OS |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[[(2R,4S,5S)-5-(piperidin-1-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea |
| SMILES | COCCNC(=S)NC[C@H]1C[C@@H]2CCN1C[C@@H]2CN1CCCCC1 |
| InChI | InChI=1S/C18H34N4OS/c1-23-10-6-19-18(24)20-12-17-11-15-5-9-22(17)14-16(15)13-21-7-3-2-4-8-21/h15-17H,2-14H2,1H3,(H2,19,20,24)/t15-,16-,17+/m0/s1 |
| InChIKey | RDUJRPLBEGVJLZ-YESZJQIVSA-N |
| XLogP | 1.29 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|