C18H27FN4O5 — CID 25390402
N-[2-(dimethylamino)ethyl]-2-[(2S,3R,4S,5R)-5-[[(3-fluorophenyl)carbamoylamino]methyl]-3,4-dihydroxyoxolan-2-yl]acetamide (PubChem CID 25390402) has the molecular formula C18H27FN4O5 and a molecular weight of 398.44 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-[(2S,3R,4S,5R)-5-[[(3-fluorophenyl)carbamoylamino]methyl]-3,4-dihydroxyoxolan-2-yl]acetamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-[(2S,3R,4S,5R)-5-[[(3-fluorophenyl)carbamoylamino]methyl]-3,4-dihydroxyoxolan-2-yl]acetamide |
|---|---|
| PubChem CID | 25390402 |
| Molecular Formula | C18H27FN4O5 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-[(2S,3R,4S,5R)-5-[[(3-fluorophenyl)carbamoylamino]methyl]-3,4-dihydroxyoxolan-2-yl]acetamide |
| SMILES | CN(C)CCNC(=O)C[C@@H]1O[C@H](CNC(=O)Nc2cccc(F)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H27FN4O5/c1-23(2)7-6-20-15(24)9-13-16(25)17(26)14(28-13)10-21-18(27)22-12-5-3-4-11(19)8-12/h3-5,8,13-14,16-17,25-26H,6-7,9-10H2,1-2H3,(H,20,24)(H2,21,22,27)/t13-,14+,16-,17+/m0/s1 |
| InChIKey | GSORDLIFNBCYKN-HDEZJCGLSA-N |
| XLogP | -0.50 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |