About 2-(3-fluorophenyl)-N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)acetamide
2-(3-fluorophenyl)-N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)acetamide (PubChem CID 25390779) has the molecular formula C19H14FN3OS
and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)acetamide.
Molecular Properties
| Compound Name | 2-(3-fluorophenyl)-N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)acetamide |
| PubChem CID | 25390779 |
| Molecular Formula | C19H14FN3OS |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-(3-fluorophenyl)-N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)acetamide |
| SMILES | O=C(Cc1cccc(F)c1)Nc1c(-c2ccccc2)nc2sccn12 |
| InChI | InChI=1S/C19H14FN3OS/c20-15-8-4-5-13(11-15)12-16(24)21-18-17(14-6-2-1-3-7-14)22-19-23(18)9-10-25-19/h1-11H,12H2,(H,21,24) |
| InChIKey | DWPNQGSMFCLSHB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-fluorophenyl)-N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-fluorophenyl)-N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)acetamide?
The IUPAC name of 2-(3-fluorophenyl)-N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)acetamide (CID 25390779) is 2-(3-fluorophenyl)-N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)acetamide.
What is the SMILES notation for 2-(3-fluorophenyl)-N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)acetamide?
The canonical SMILES for 2-(3-fluorophenyl)-N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)acetamide is O=C(Cc1cccc(F)c1)Nc1c(-c2ccccc2)nc2sccn12.
What is the InChIKey of 2-(3-fluorophenyl)-N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)acetamide?
The InChIKey is DWPNQGSMFCLSHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14FN3OS/c20-15-8-4-5-13(11-15)12-16(24)21-18-17(14-6-2-1-3-7-14)22-19-23(18)9-10-25-19/h1-11H,12H2,(H,21,24).
What are the key properties of 2-(3-fluorophenyl)-N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)acetamide?
2-(3-fluorophenyl)-N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)acetamide has a molecular weight of 351.41 g/mol, XLogP of 4.38, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluorophenyl)-N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)acetamide is sourced from PubChem (CID 25390779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).